C13H12N2O6 — CID 61070986
3-(3,4-dihydroxyphenyl)-2-(1,2-oxazole-5-carbonylamino)propanoic acid (PubChem CID 61070986) has the molecular formula C13H12N2O6 and a molecular weight of 292.25 g/mol. Its IUPAC name is 3-(3,4-dihydroxyphenyl)-2-(1,2-oxazole-5-carbonylamino)propanoic acid.
| Compound Name | 3-(3,4-dihydroxyphenyl)-2-(1,2-oxazole-5-carbonylamino)propanoic acid |
|---|---|
| PubChem CID | 61070986 |
| Molecular Formula | C13H12N2O6 |
| Molecular Weight | 292.25 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | 3-(3,4-dihydroxyphenyl)-2-(1,2-oxazole-5-carbonylamino)propanoic acid |
| SMILES | O=C(NC(Cc1ccc(O)c(O)c1)C(=O)O)c1ccno1 |
| InChI | InChI=1S/C13H12N2O6/c16-9-2-1-7(6-10(9)17)5-8(13(19)20)15-12(18)11-3-4-14-21-11/h1-4,6,8,16-17H,5H2,(H,15,18)(H,19,20) |
| InChIKey | KUGXIKBYLRPUCL-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 132.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.25 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|