C21H21NO3 — CID 97352026
N-[(2S)-1-(3,4-dihydroxyphenyl)propan-2-yl]-2-naphthalen-1-ylacetamide (PubChem CID 97352026) has the molecular formula C21H21NO3 and a molecular weight of 335.40 g/mol. Its IUPAC name is N-[(2S)-1-(3,4-dihydroxyphenyl)propan-2-yl]-2-naphthalen-1-ylacetamide.
| Compound Name | N-[(2S)-1-(3,4-dihydroxyphenyl)propan-2-yl]-2-naphthalen-1-ylacetamide |
|---|---|
| PubChem CID | 97352026 |
| Molecular Formula | C21H21NO3 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | N-[(2S)-1-(3,4-dihydroxyphenyl)propan-2-yl]-2-naphthalen-1-ylacetamide |
| SMILES | C[C@@H](Cc1ccc(O)c(O)c1)NC(=O)Cc1cccc2ccccc12 |
| InChI | InChI=1S/C21H21NO3/c1-14(11-15-9-10-19(23)20(24)12-15)22-21(25)13-17-7-4-6-16-5-2-3-8-18(16)17/h2-10,12,14,23-24H,11,13H2,1H3,(H,22,25)/t14-/m0/s1 |
| InChIKey | KELBPVFMKCZYEU-AWEZNQCLSA-N |
| XLogP | 3.54 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|