C19H28N2O4 — CID 124626571
(3S)-4-cyclopentyl-N-[(2R)-1-(3,4-dihydroxyphenyl)propan-2-yl]morpholine-3-carboxamide (PubChem CID 124626571) has the molecular formula C19H28N2O4 and a molecular weight of 348.44 g/mol. Its IUPAC name is (3S)-4-cyclopentyl-N-[(2R)-1-(3,4-dihydroxyphenyl)propan-2-yl]morpholine-3-carboxamide.
| Compound Name | (3S)-4-cyclopentyl-N-[(2R)-1-(3,4-dihydroxyphenyl)propan-2-yl]morpholine-3-carboxamide |
|---|---|
| PubChem CID | 124626571 |
| Molecular Formula | C19H28N2O4 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | (3S)-4-cyclopentyl-N-[(2R)-1-(3,4-dihydroxyphenyl)propan-2-yl]morpholine-3-carboxamide |
| SMILES | C[C@H](Cc1ccc(O)c(O)c1)NC(=O)[C@@H]1COCCN1C1CCCC1 |
| InChI | InChI=1S/C19H28N2O4/c1-13(10-14-6-7-17(22)18(23)11-14)20-19(24)16-12-25-9-8-21(16)15-4-2-3-5-15/h6-7,11,13,15-16,22-23H,2-5,8-10,12H2,1H3,(H,20,24)/t13-,16+/m1/s1 |
| InChIKey | FLRUNXFCXCPHGL-CJNGLKHVSA-N |
| XLogP | 1.79 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|