C19H26N4O2 — CID 124620774
(3S)-N-[(1S)-1-(1H-benzimidazol-2-yl)ethyl]-4-cyclopentylmorpholine-3-carboxamide (PubChem CID 124620774) has the molecular formula C19H26N4O2 and a molecular weight of 342.44 g/mol. Its IUPAC name is (3S)-N-[(1S)-1-(1H-benzimidazol-2-yl)ethyl]-4-cyclopentylmorpholine-3-carboxamide.
| Compound Name | (3S)-N-[(1S)-1-(1H-benzimidazol-2-yl)ethyl]-4-cyclopentylmorpholine-3-carboxamide |
|---|---|
| PubChem CID | 124620774 |
| Molecular Formula | C19H26N4O2 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.21 |
| IUPAC Name | (3S)-N-[(1S)-1-(1H-benzimidazol-2-yl)ethyl]-4-cyclopentylmorpholine-3-carboxamide |
| SMILES | C[C@H](NC(=O)[C@@H]1COCCN1C1CCCC1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C19H26N4O2/c1-13(18-21-15-8-4-5-9-16(15)22-18)20-19(24)17-12-25-11-10-23(17)14-6-2-3-7-14/h4-5,8-9,13-14,17H,2-3,6-7,10-12H2,1H3,(H,20,24)(H,21,22)/t13-,17-/m0/s1 |
| InChIKey | YXZLNIGXDQREFL-GUYCJALGSA-N |
| XLogP | 2.38 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |