C19H25N3O2 — CID 124884894
(3R)-N-[(1S)-1-(3-cyanophenyl)ethyl]-4-cyclopentylmorpholine-3-carboxamide (PubChem CID 124884894) has the molecular formula C19H25N3O2 and a molecular weight of 327.43 g/mol. Its IUPAC name is (3R)-N-[(1S)-1-(3-cyanophenyl)ethyl]-4-cyclopentylmorpholine-3-carboxamide.
| Compound Name | (3R)-N-[(1S)-1-(3-cyanophenyl)ethyl]-4-cyclopentylmorpholine-3-carboxamide |
|---|---|
| PubChem CID | 124884894 |
| Molecular Formula | C19H25N3O2 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.19 |
| IUPAC Name | (3R)-N-[(1S)-1-(3-cyanophenyl)ethyl]-4-cyclopentylmorpholine-3-carboxamide |
| SMILES | C[C@H](NC(=O)[C@H]1COCCN1C1CCCC1)c1cccc(C#N)c1 |
| InChI | InChI=1S/C19H25N3O2/c1-14(16-6-4-5-15(11-16)12-20)21-19(23)18-13-24-10-9-22(18)17-7-2-3-8-17/h4-6,11,14,17-18H,2-3,7-10,13H2,1H3,(H,21,23)/t14-,18+/m0/s1 |
| InChIKey | IVWVCKUIYLQSED-KBXCAEBGSA-N |
| XLogP | 2.38 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |