C11H20ClNO3 — CID 107847283
N-(6-chlorohexyl)-1,4-dioxane-2-carboxamide (PubChem CID 107847283) has the molecular formula C11H20ClNO3 and a molecular weight of 249.74 g/mol. Its IUPAC name is N-(6-chlorohexyl)-1,4-dioxane-2-carboxamide.
| Compound Name | N-(6-chlorohexyl)-1,4-dioxane-2-carboxamide |
|---|---|
| PubChem CID | 107847283 |
| Molecular Formula | C11H20ClNO3 |
| Molecular Weight | 249.74 g/mol |
| Exact Mass | 249.11 |
| IUPAC Name | N-(6-chlorohexyl)-1,4-dioxane-2-carboxamide |
| SMILES | O=C(NCCCCCCCl)C1COCCO1 |
| InChI | InChI=1S/C11H20ClNO3/c12-5-3-1-2-4-6-13-11(14)10-9-15-7-8-16-10/h10H,1-9H2,(H,13,14) |
| InChIKey | MMQKMLYRFJEGTB-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.74 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|