C11H20BrNO3 — CID 106157418
N-(5-bromo-4-methylpentyl)-1,4-dioxane-2-carboxamide (PubChem CID 106157418) has the molecular formula C11H20BrNO3 and a molecular weight of 294.19 g/mol. Its IUPAC name is N-(5-bromo-4-methylpentyl)-1,4-dioxane-2-carboxamide.
| Compound Name | N-(5-bromo-4-methylpentyl)-1,4-dioxane-2-carboxamide |
|---|---|
| PubChem CID | 106157418 |
| Molecular Formula | C11H20BrNO3 |
| Molecular Weight | 294.19 g/mol |
| Exact Mass | 293.06 |
| IUPAC Name | N-(5-bromo-4-methylpentyl)-1,4-dioxane-2-carboxamide |
| SMILES | CC(CBr)CCCNC(=O)C1COCCO1 |
| InChI | InChI=1S/C11H20BrNO3/c1-9(7-12)3-2-4-13-11(14)10-8-15-5-6-16-10/h9-10H,2-8H2,1H3,(H,13,14) |
| InChIKey | IYSLOGPZHOKDRV-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.19 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|