C10H18BrNO4 — CID 106307776
N-[3-(2-bromoethoxy)propyl]-1,4-dioxane-2-carboxamide (PubChem CID 106307776) has the molecular formula C10H18BrNO4 and a molecular weight of 296.16 g/mol. Its IUPAC name is N-[3-(2-bromoethoxy)propyl]-1,4-dioxane-2-carboxamide.
| Compound Name | N-[3-(2-bromoethoxy)propyl]-1,4-dioxane-2-carboxamide |
|---|---|
| PubChem CID | 106307776 |
| Molecular Formula | C10H18BrNO4 |
| Molecular Weight | 296.16 g/mol |
| Exact Mass | 295.04 |
| IUPAC Name | N-[3-(2-bromoethoxy)propyl]-1,4-dioxane-2-carboxamide |
| SMILES | O=C(NCCCOCCBr)C1COCCO1 |
| InChI | InChI=1S/C10H18BrNO4/c11-2-5-14-4-1-3-12-10(13)9-8-15-6-7-16-9/h9H,1-8H2,(H,12,13) |
| InChIKey | SZPBQHXFTHSWNY-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.16 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|