C9H16N4O3 — CID 106386429
N-(4-azidobutyl)-1,4-dioxane-2-carboxamide (PubChem CID 106386429) has the molecular formula C9H16N4O3 and a molecular weight of 228.25 g/mol. Its IUPAC name is N-(4-azidobutyl)-1,4-dioxane-2-carboxamide.
| Compound Name | N-(4-azidobutyl)-1,4-dioxane-2-carboxamide |
|---|---|
| PubChem CID | 106386429 |
| Molecular Formula | C9H16N4O3 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.12 |
| IUPAC Name | N-(4-azidobutyl)-1,4-dioxane-2-carboxamide |
| SMILES | [N-]=[N+]=NCCCCNC(=O)C1COCCO1 |
| InChI | InChI=1S/C9H16N4O3/c10-13-12-4-2-1-3-11-9(14)8-7-15-5-6-16-8/h8H,1-7H2,(H,11,14) |
| InChIKey | UVEOBDSMIMAYJX-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 96.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|