C12H20ClNO3 — CID 114301649
N-[(2-chlorocyclohexyl)methyl]-1,4-dioxane-2-carboxamide (PubChem CID 114301649) has the molecular formula C12H20ClNO3 and a molecular weight of 261.75 g/mol. Its IUPAC name is N-[(2-chlorocyclohexyl)methyl]-1,4-dioxane-2-carboxamide.
| Compound Name | N-[(2-chlorocyclohexyl)methyl]-1,4-dioxane-2-carboxamide |
|---|---|
| PubChem CID | 114301649 |
| Molecular Formula | C12H20ClNO3 |
| Molecular Weight | 261.75 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | N-[(2-chlorocyclohexyl)methyl]-1,4-dioxane-2-carboxamide |
| SMILES | O=C(NCC1CCCCC1Cl)C1COCCO1 |
| InChI | InChI=1S/C12H20ClNO3/c13-10-4-2-1-3-9(10)7-14-12(15)11-8-16-5-6-17-11/h9-11H,1-8H2,(H,14,15) |
| InChIKey | LOIQOPSCECJODD-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.75 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|