C12H21NO4 — CID 113241320
N-[(3-hydroxycyclohexyl)methyl]-1,4-dioxane-2-carboxamide (PubChem CID 113241320) has the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. Its IUPAC name is N-[(3-hydroxycyclohexyl)methyl]-1,4-dioxane-2-carboxamide.
| Compound Name | N-[(3-hydroxycyclohexyl)methyl]-1,4-dioxane-2-carboxamide |
|---|---|
| PubChem CID | 113241320 |
| Molecular Formula | C12H21NO4 |
| Molecular Weight | 243.30 g/mol |
| Exact Mass | 243.15 |
| IUPAC Name | N-[(3-hydroxycyclohexyl)methyl]-1,4-dioxane-2-carboxamide |
| SMILES | O=C(NCC1CCCC(O)C1)C1COCCO1 |
| InChI | InChI=1S/C12H21NO4/c14-10-3-1-2-9(6-10)7-13-12(15)11-8-16-4-5-17-11/h9-11,14H,1-8H2,(H,13,15) |
| InChIKey | NFEKBBYENHGUMX-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.30 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |