C12H24N2O3 — CID 104929916
1-(1-hydroxy-4,4-dimethylpentan-3-yl)-3-(oxolan-3-yl)urea (PubChem CID 104929916) has the molecular formula C12H24N2O3 and a molecular weight of 244.33 g/mol. Its IUPAC name is 1-(1-hydroxy-4,4-dimethylpentan-3-yl)-3-(oxolan-3-yl)urea.
| Compound Name | 1-(1-hydroxy-4,4-dimethylpentan-3-yl)-3-(oxolan-3-yl)urea |
|---|---|
| PubChem CID | 104929916 |
| Molecular Formula | C12H24N2O3 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.18 |
| IUPAC Name | 1-(1-hydroxy-4,4-dimethylpentan-3-yl)-3-(oxolan-3-yl)urea |
| SMILES | CC(C)(C)C(CCO)NC(=O)NC1CCOC1 |
| InChI | InChI=1S/C12H24N2O3/c1-12(2,3)10(4-6-15)14-11(16)13-9-5-7-17-8-9/h9-10,15H,4-8H2,1-3H3,(H2,13,14,16) |
| InChIKey | WUPRVVYCTBWYKI-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |