C12H24N2O2 — CID 115759088
1-(oxolan-3-yl)-3-(2,3,3-trimethylbutyl)urea (PubChem CID 115759088) has the molecular formula C12H24N2O2 and a molecular weight of 228.34 g/mol. Its IUPAC name is 1-(oxolan-3-yl)-3-(2,3,3-trimethylbutyl)urea.
| Compound Name | 1-(oxolan-3-yl)-3-(2,3,3-trimethylbutyl)urea |
|---|---|
| PubChem CID | 115759088 |
| Molecular Formula | C12H24N2O2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.18 |
| IUPAC Name | 1-(oxolan-3-yl)-3-(2,3,3-trimethylbutyl)urea |
| SMILES | CC(CNC(=O)NC1CCOC1)C(C)(C)C |
| InChI | InChI=1S/C12H24N2O2/c1-9(12(2,3)4)7-13-11(15)14-10-5-6-16-8-10/h9-10H,5-8H2,1-4H3,(H2,13,14,15) |
| InChIKey | GOTOPZZLGCNMAZ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |