C14H28N2O2 — CID 115759165
1-(2,2-dimethylheptyl)-3-(oxolan-3-yl)urea (PubChem CID 115759165) has the molecular formula C14H28N2O2 and a molecular weight of 256.39 g/mol. Its IUPAC name is 1-(2,2-dimethylheptyl)-3-(oxolan-3-yl)urea.
| Compound Name | 1-(2,2-dimethylheptyl)-3-(oxolan-3-yl)urea |
|---|---|
| PubChem CID | 115759165 |
| Molecular Formula | C14H28N2O2 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.22 |
| IUPAC Name | 1-(2,2-dimethylheptyl)-3-(oxolan-3-yl)urea |
| SMILES | CCCCCC(C)(C)CNC(=O)NC1CCOC1 |
| InChI | InChI=1S/C14H28N2O2/c1-4-5-6-8-14(2,3)11-15-13(17)16-12-7-9-18-10-12/h12H,4-11H2,1-3H3,(H2,15,16,17) |
| InChIKey | DRDNVCFUWPDJRK-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|