C8H16N2O3 — CID 107218691
N-[(2R)-1-hydroxypropan-2-yl]morpholine-3-carboxamide (PubChem CID 107218691) has the molecular formula C8H16N2O3 and a molecular weight of 188.23 g/mol. Its IUPAC name is N-[(2R)-1-hydroxypropan-2-yl]morpholine-3-carboxamide.
| Compound Name | N-[(2R)-1-hydroxypropan-2-yl]morpholine-3-carboxamide |
|---|---|
| PubChem CID | 107218691 |
| Molecular Formula | C8H16N2O3 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | N-[(2R)-1-hydroxypropan-2-yl]morpholine-3-carboxamide |
| SMILES | C[C@H](CO)NC(=O)C1COCCN1 |
| InChI | InChI=1S/C8H16N2O3/c1-6(4-11)10-8(12)7-5-13-3-2-9-7/h6-7,9,11H,2-5H2,1H3,(H,10,12)/t6-,7?/m1/s1 |
| InChIKey | DVCUOEPOTHVAGX-ULUSZKPHSA-N |
| XLogP | -1.53 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |