C9H18N2O3 — CID 83177558
N-(4-hydroxybutan-2-yl)morpholine-3-carboxamide (PubChem CID 83177558) has the molecular formula C9H18N2O3 and a molecular weight of 202.25 g/mol. Its IUPAC name is N-(4-hydroxybutan-2-yl)morpholine-3-carboxamide.
| Compound Name | N-(4-hydroxybutan-2-yl)morpholine-3-carboxamide |
|---|---|
| PubChem CID | 83177558 |
| Molecular Formula | C9H18N2O3 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.13 |
| IUPAC Name | N-(4-hydroxybutan-2-yl)morpholine-3-carboxamide |
| SMILES | CC(CCO)NC(=O)C1COCCN1 |
| InChI | InChI=1S/C9H18N2O3/c1-7(2-4-12)11-9(13)8-6-14-5-3-10-8/h7-8,10,12H,2-6H2,1H3,(H,11,13) |
| InChIKey | ZIGBDROHOKOIAG-UHFFFAOYSA-N |
| XLogP | -1.14 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |