C12H22ClN3O3 — CID 119740516
N-[1-(2-oxopyrrolidin-1-yl)propan-2-yl]morpholine-3-carboxamide;hydrochloride (PubChem CID 119740516) has the molecular formula C12H22ClN3O3 and a molecular weight of 291.78 g/mol. Its IUPAC name is N-[1-(2-oxopyrrolidin-1-yl)propan-2-yl]morpholine-3-carboxamide;hydrochloride.
| Compound Name | N-[1-(2-oxopyrrolidin-1-yl)propan-2-yl]morpholine-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119740516 |
| Molecular Formula | C12H22ClN3O3 |
| Molecular Weight | 291.78 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | N-[1-(2-oxopyrrolidin-1-yl)propan-2-yl]morpholine-3-carboxamide;hydrochloride |
| SMILES | CC(CN1CCCC1=O)NC(=O)C1COCCN1.Cl |
| InChI | InChI=1S/C12H21N3O3.ClH/c1-9(7-15-5-2-3-11(15)16)14-12(17)10-8-18-6-4-13-10;/h9-10,13H,2-8H2,1H3,(H,14,17);1H |
| InChIKey | GUVOOFSZWYHMNX-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.78 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |