C10H13N3O5 — CID 170436902
(2S)-6-diazo-2-[[(2S)-oxetane-2-carbonyl]amino]-5-oxohexanoic acid (PubChem CID 170436902) has the molecular formula C10H13N3O5 and a molecular weight of 255.23 g/mol. Its IUPAC name is (2S)-6-diazo-2-[[(2S)-oxetane-2-carbonyl]amino]-5-oxohexanoic acid.
| Compound Name | (2S)-6-diazo-2-[[(2S)-oxetane-2-carbonyl]amino]-5-oxohexanoic acid |
|---|---|
| PubChem CID | 170436902 |
| Molecular Formula | C10H13N3O5 |
| Molecular Weight | 255.23 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | (2S)-6-diazo-2-[[(2S)-oxetane-2-carbonyl]amino]-5-oxohexanoic acid |
| SMILES | [N-]=[N+]=CC(=O)CC[C@H](NC(=O)[C@@H]1CCO1)C(=O)O |
| InChI | InChI=1S/C10H13N3O5/c11-12-5-6(14)1-2-7(10(16)17)13-9(15)8-3-4-18-8/h5,7-8H,1-4H2,(H,13,15)(H,16,17)/t7-,8-/m0/s1 |
| InChIKey | VZMFDIXHBNQJLN-YUMQZZPRSA-N |
| XLogP | -1.01 |
| TPSA | 129.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.23 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|