C13H19N3O5 — CID 170437086
2-[(2-cyclopentyl-2-hydroxyacetyl)amino]-6-diazo-5-oxohexanoic acid (PubChem CID 170437086) has the molecular formula C13H19N3O5 and a molecular weight of 297.31 g/mol. Its IUPAC name is 2-[(2-cyclopentyl-2-hydroxyacetyl)amino]-6-diazo-5-oxohexanoic acid.
| Compound Name | 2-[(2-cyclopentyl-2-hydroxyacetyl)amino]-6-diazo-5-oxohexanoic acid |
|---|---|
| PubChem CID | 170437086 |
| Molecular Formula | C13H19N3O5 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | 2-[(2-cyclopentyl-2-hydroxyacetyl)amino]-6-diazo-5-oxohexanoic acid |
| SMILES | [N-]=[N+]=CC(=O)CCC(NC(=O)C(O)C1CCCC1)C(=O)O |
| InChI | InChI=1S/C13H19N3O5/c14-15-7-9(17)5-6-10(13(20)21)16-12(19)11(18)8-3-1-2-4-8/h7-8,10-11,18H,1-6H2,(H,16,19)(H,20,21) |
| InChIKey | WWMVIQGRDMDGDX-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 140.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|