C14H23N3O4 — CID 175133970
2,3-dimethyl-6-(oxolane-2-carbonylamino)hept-2-enediamide (PubChem CID 175133970) has the molecular formula C14H23N3O4 and a molecular weight of 297.36 g/mol. Its IUPAC name is 2,3-dimethyl-6-(oxolane-2-carbonylamino)hept-2-enediamide.
| Compound Name | 2,3-dimethyl-6-(oxolane-2-carbonylamino)hept-2-enediamide |
|---|---|
| PubChem CID | 175133970 |
| Molecular Formula | C14H23N3O4 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | 2,3-dimethyl-6-(oxolane-2-carbonylamino)hept-2-enediamide |
| SMILES | CC(CCC(NC(=O)C1CCCO1)C(N)=O)=C(C)C(N)=O |
| InChI | InChI=1S/C14H23N3O4/c1-8(9(2)12(15)18)5-6-10(13(16)19)17-14(20)11-4-3-7-21-11/h10-11H,3-7H2,1-2H3,(H2,15,18)(H2,16,19)(H,17,20) |
| InChIKey | VWKCJFZKCGFIML-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 124.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|