C18H31NO5 — CID 22812711
(2S)-2-[[4-(4-methylpentyl)cyclohexanecarbonyl]amino]pentanedioic acid (PubChem CID 22812711) has the molecular formula C18H31NO5 and a molecular weight of 341.45 g/mol. Its IUPAC name is (2S)-2-[[4-(4-methylpentyl)cyclohexanecarbonyl]amino]pentanedioic acid.
| Compound Name | (2S)-2-[[4-(4-methylpentyl)cyclohexanecarbonyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 22812711 |
| Molecular Formula | C18H31NO5 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.22 |
| IUPAC Name | (2S)-2-[[4-(4-methylpentyl)cyclohexanecarbonyl]amino]pentanedioic acid |
| SMILES | CC(C)CCCC1CCC(C(=O)N[C@@H](CCC(=O)O)C(=O)O)CC1 |
| InChI | InChI=1S/C18H31NO5/c1-12(2)4-3-5-13-6-8-14(9-7-13)17(22)19-15(18(23)24)10-11-16(20)21/h12-15H,3-11H2,1-2H3,(H,19,22)(H,20,21)(H,23,24)/t13?,14?,15-/m0/s1 |
| InChIKey | NWZVVKIBWRLNQU-NRXISQOPSA-N |
| XLogP | 3.05 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |