C14H20ClFN2O — CID 126622634
4-fluoro-N-(3-phenylpropyl)pyrrolidine-2-carboxamide;hydrochloride (PubChem CID 126622634) has the molecular formula C14H20ClFN2O and a molecular weight of 286.78 g/mol. Its IUPAC name is 4-fluoro-N-(3-phenylpropyl)pyrrolidine-2-carboxamide;hydrochloride.
| Compound Name | 4-fluoro-N-(3-phenylpropyl)pyrrolidine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 126622634 |
| Molecular Formula | C14H20ClFN2O |
| Molecular Weight | 286.78 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | 4-fluoro-N-(3-phenylpropyl)pyrrolidine-2-carboxamide;hydrochloride |
| SMILES | Cl.O=C(NCCCc1ccccc1)C1CC(F)CN1 |
| InChI | InChI=1S/C14H19FN2O.ClH/c15-12-9-13(17-10-12)14(18)16-8-4-7-11-5-2-1-3-6-11;/h1-3,5-6,12-13,17H,4,7-10H2,(H,16,18);1H |
| InChIKey | YKQHWCBXPJRIRC-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.78 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|