C15H22N2O4S — CID 162205045
(3S,5S)-5-(4-phenylbutylcarbamoyl)pyrrolidine-3-sulfonic acid (PubChem CID 162205045) has the molecular formula C15H22N2O4S and a molecular weight of 326.42 g/mol. Its IUPAC name is (3S,5S)-5-(4-phenylbutylcarbamoyl)pyrrolidine-3-sulfonic acid.
| Compound Name | (3S,5S)-5-(4-phenylbutylcarbamoyl)pyrrolidine-3-sulfonic acid |
|---|---|
| PubChem CID | 162205045 |
| Molecular Formula | C15H22N2O4S |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | (3S,5S)-5-(4-phenylbutylcarbamoyl)pyrrolidine-3-sulfonic acid |
| SMILES | O=C(NCCCCc1ccccc1)[C@@H]1C[C@H](S(=O)(=O)O)CN1 |
| InChI | InChI=1S/C15H22N2O4S/c18-15(14-10-13(11-17-14)22(19,20)21)16-9-5-4-8-12-6-2-1-3-7-12/h1-3,6-7,13-14,17H,4-5,8-11H2,(H,16,18)(H,19,20,21)/t13-,14-/m0/s1 |
| InChIKey | NPWUVUOWWBCQAL-KBPBESRZSA-N |
| XLogP | 0.74 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|