C10H20N2O4 — CID 60660409
methyl 2-[[2-(3-methoxypropylamino)-2-oxoethyl]-methylamino]acetate (PubChem CID 60660409) has the molecular formula C10H20N2O4 and a molecular weight of 232.28 g/mol. Its IUPAC name is methyl 2-[[2-(3-methoxypropylamino)-2-oxoethyl]-methylamino]acetate.
| Compound Name | methyl 2-[[2-(3-methoxypropylamino)-2-oxoethyl]-methylamino]acetate |
|---|---|
| PubChem CID | 60660409 |
| Molecular Formula | C10H20N2O4 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.14 |
| IUPAC Name | methyl 2-[[2-(3-methoxypropylamino)-2-oxoethyl]-methylamino]acetate |
| SMILES | COCCCNC(=O)CN(C)CC(=O)OC |
| InChI | InChI=1S/C10H20N2O4/c1-12(8-10(14)16-3)7-9(13)11-5-4-6-15-2/h4-8H2,1-3H3,(H,11,13) |
| InChIKey | AUBNXGZWMOYBBG-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|