C9H17N3O2 — CID 60715078
2-[cyanomethyl(methyl)amino]-N-(3-methoxypropyl)acetamide (PubChem CID 60715078) has the molecular formula C9H17N3O2 and a molecular weight of 199.25 g/mol. Its IUPAC name is 2-[cyanomethyl(methyl)amino]-N-(3-methoxypropyl)acetamide.
| Compound Name | 2-[cyanomethyl(methyl)amino]-N-(3-methoxypropyl)acetamide |
|---|---|
| PubChem CID | 60715078 |
| Molecular Formula | C9H17N3O2 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.13 |
| IUPAC Name | 2-[cyanomethyl(methyl)amino]-N-(3-methoxypropyl)acetamide |
| SMILES | COCCCNC(=O)CN(C)CC#N |
| InChI | InChI=1S/C9H17N3O2/c1-12(6-4-10)8-9(13)11-5-3-7-14-2/h3,5-8H2,1-2H3,(H,11,13) |
| InChIKey | QTUGQJPXOCQAHD-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|