C13H27N3O4 — CID 55445610
2-[[2-(1-methoxypropan-2-ylamino)-2-oxoethyl]-methylamino]-N-(3-methoxypropyl)acetamide (PubChem CID 55445610) has the molecular formula C13H27N3O4 and a molecular weight of 289.38 g/mol. Its IUPAC name is 2-[[2-(1-methoxypropan-2-ylamino)-2-oxoethyl]-methylamino]-N-(3-methoxypropyl)acetamide.
| Compound Name | 2-[[2-(1-methoxypropan-2-ylamino)-2-oxoethyl]-methylamino]-N-(3-methoxypropyl)acetamide |
|---|---|
| PubChem CID | 55445610 |
| Molecular Formula | C13H27N3O4 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | 2-[[2-(1-methoxypropan-2-ylamino)-2-oxoethyl]-methylamino]-N-(3-methoxypropyl)acetamide |
| SMILES | COCCCNC(=O)CN(C)CC(=O)NC(C)COC |
| InChI | InChI=1S/C13H27N3O4/c1-11(10-20-4)15-13(18)9-16(2)8-12(17)14-6-5-7-19-3/h11H,5-10H2,1-4H3,(H,14,17)(H,15,18) |
| InChIKey | IFNOAYXXUHUGDK-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|