C11H25N3O3 — CID 63760493
2-[(2-amino-3-methoxypropyl)-methylamino]-N-(1-methoxypropan-2-yl)acetamide (PubChem CID 63760493) has the molecular formula C11H25N3O3 and a molecular weight of 247.34 g/mol. Its IUPAC name is 2-[(2-amino-3-methoxypropyl)-methylamino]-N-(1-methoxypropan-2-yl)acetamide.
| Compound Name | 2-[(2-amino-3-methoxypropyl)-methylamino]-N-(1-methoxypropan-2-yl)acetamide |
|---|---|
| PubChem CID | 63760493 |
| Molecular Formula | C11H25N3O3 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.19 |
| IUPAC Name | 2-[(2-amino-3-methoxypropyl)-methylamino]-N-(1-methoxypropan-2-yl)acetamide |
| SMILES | COCC(N)CN(C)CC(=O)NC(C)COC |
| InChI | InChI=1S/C11H25N3O3/c1-9(7-16-3)13-11(15)6-14(2)5-10(12)8-17-4/h9-10H,5-8,12H2,1-4H3,(H,13,15) |
| InChIKey | UWDIKQJYXUNSFM-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |