C17H30N4O3 — CID 51261193
2-[[2-[(1-cyanocyclohexyl)-methylamino]-2-oxoethyl]-methylamino]-N-(3-methoxypropyl)acetamide (PubChem CID 51261193) has the molecular formula C17H30N4O3 and a molecular weight of 338.45 g/mol. Its IUPAC name is 2-[[2-[(1-cyanocyclohexyl)-methylamino]-2-oxoethyl]-methylamino]-N-(3-methoxypropyl)acetamide.
| Compound Name | 2-[[2-[(1-cyanocyclohexyl)-methylamino]-2-oxoethyl]-methylamino]-N-(3-methoxypropyl)acetamide |
|---|---|
| PubChem CID | 51261193 |
| Molecular Formula | C17H30N4O3 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.23 |
| IUPAC Name | 2-[[2-[(1-cyanocyclohexyl)-methylamino]-2-oxoethyl]-methylamino]-N-(3-methoxypropyl)acetamide |
| SMILES | COCCCNC(=O)CN(C)CC(=O)N(C)C1(C#N)CCCCC1 |
| InChI | InChI=1S/C17H30N4O3/c1-20(12-15(22)19-10-7-11-24-3)13-16(23)21(2)17(14-18)8-5-4-6-9-17/h4-13H2,1-3H3,(H,19,22) |
| InChIKey | DHVUHEDRXQKJOT-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 85.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|