C15H20Cl2F2N4O — CID 120612493
3-(2-aminophenyl)-N-[[1-(difluoromethyl)imidazol-2-yl]methyl]-N-methylpropanamide;dihydrochloride (PubChem CID 120612493) has the molecular formula C15H20Cl2F2N4O and a molecular weight of 381.25 g/mol. Its IUPAC name is 3-(2-aminophenyl)-N-[[1-(difluoromethyl)imidazol-2-yl]methyl]-N-methylpropanamide;dihydrochloride.
| Compound Name | 3-(2-aminophenyl)-N-[[1-(difluoromethyl)imidazol-2-yl]methyl]-N-methylpropanamide;dihydrochloride |
|---|---|
| PubChem CID | 120612493 |
| Molecular Formula | C15H20Cl2F2N4O |
| Molecular Weight | 381.25 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | 3-(2-aminophenyl)-N-[[1-(difluoromethyl)imidazol-2-yl]methyl]-N-methylpropanamide;dihydrochloride |
| SMILES | CN(Cc1nccn1C(F)F)C(=O)CCc1ccccc1N.Cl.Cl |
| InChI | InChI=1S/C15H18F2N4O.2ClH/c1-20(10-13-19-8-9-21(13)15(16)17)14(22)7-6-11-4-2-3-5-12(11)18;;/h2-5,8-9,15H,6-7,10,18H2,1H3;2*1H |
| InChIKey | ZHZCBDMSODEGGM-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.25 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|