C14H14ClF2N3O — CID 134044459
2-(4-chlorophenyl)-N-[[1-(difluoromethyl)imidazol-2-yl]methyl]-N-methylacetamide (PubChem CID 134044459) has the molecular formula C14H14ClF2N3O and a molecular weight of 313.74 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-[[1-(difluoromethyl)imidazol-2-yl]methyl]-N-methylacetamide.
| Compound Name | 2-(4-chlorophenyl)-N-[[1-(difluoromethyl)imidazol-2-yl]methyl]-N-methylacetamide |
|---|---|
| PubChem CID | 134044459 |
| Molecular Formula | C14H14ClF2N3O |
| Molecular Weight | 313.74 g/mol |
| Exact Mass | 313.08 |
| IUPAC Name | 2-(4-chlorophenyl)-N-[[1-(difluoromethyl)imidazol-2-yl]methyl]-N-methylacetamide |
| SMILES | CN(Cc1nccn1C(F)F)C(=O)Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H14ClF2N3O/c1-19(9-12-18-6-7-20(12)14(16)17)13(21)8-10-2-4-11(15)5-3-10/h2-7,14H,8-9H2,1H3 |
| InChIKey | ZXWNBMUCBCHJSL-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.74 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |