C17H15F2N3O — CID 38342160
N-[[1-(difluoromethyl)imidazol-2-yl]methyl]-N-methylnaphthalene-2-carboxamide (PubChem CID 38342160) has the molecular formula C17H15F2N3O and a molecular weight of 315.32 g/mol. Its IUPAC name is N-[[1-(difluoromethyl)imidazol-2-yl]methyl]-N-methylnaphthalene-2-carboxamide.
| Compound Name | N-[[1-(difluoromethyl)imidazol-2-yl]methyl]-N-methylnaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 38342160 |
| Molecular Formula | C17H15F2N3O |
| Molecular Weight | 315.32 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | N-[[1-(difluoromethyl)imidazol-2-yl]methyl]-N-methylnaphthalene-2-carboxamide |
| SMILES | CN(Cc1nccn1C(F)F)C(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C17H15F2N3O/c1-21(11-15-20-8-9-22(15)17(18)19)16(23)14-7-6-12-4-2-3-5-13(12)10-14/h2-10,17H,11H2,1H3 |
| InChIKey | RSVBKGIOQNQWQY-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.32 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |