C15H18F2N4O3S — CID 87038968
3-[2-(benzenesulfonyl)ethyl]-1-[[1-(difluoromethyl)imidazol-2-yl]methyl]-1-methylurea (PubChem CID 87038968) has the molecular formula C15H18F2N4O3S and a molecular weight of 372.40 g/mol. Its IUPAC name is 3-[2-(benzenesulfonyl)ethyl]-1-[[1-(difluoromethyl)imidazol-2-yl]methyl]-1-methylurea.
| Compound Name | 3-[2-(benzenesulfonyl)ethyl]-1-[[1-(difluoromethyl)imidazol-2-yl]methyl]-1-methylurea |
|---|---|
| PubChem CID | 87038968 |
| Molecular Formula | C15H18F2N4O3S |
| Molecular Weight | 372.40 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | 3-[2-(benzenesulfonyl)ethyl]-1-[[1-(difluoromethyl)imidazol-2-yl]methyl]-1-methylurea |
| SMILES | CN(Cc1nccn1C(F)F)C(=O)NCCS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C15H18F2N4O3S/c1-20(11-13-18-7-9-21(13)14(16)17)15(22)19-8-10-25(23,24)12-5-3-2-4-6-12/h2-7,9,14H,8,10-11H2,1H3,(H,19,22) |
| InChIKey | CCMWKGWCQZIFAT-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.40 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |