C12H19N3O3S — CID 47148470
1-[3-(oxolan-2-ylmethoxy)propyl]-3-(1,3-thiazol-2-yl)urea (PubChem CID 47148470) has the molecular formula C12H19N3O3S and a molecular weight of 285.37 g/mol. Its IUPAC name is 1-[3-(oxolan-2-ylmethoxy)propyl]-3-(1,3-thiazol-2-yl)urea.
| Compound Name | 1-[3-(oxolan-2-ylmethoxy)propyl]-3-(1,3-thiazol-2-yl)urea |
|---|---|
| PubChem CID | 47148470 |
| Molecular Formula | C12H19N3O3S |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | 1-[3-(oxolan-2-ylmethoxy)propyl]-3-(1,3-thiazol-2-yl)urea |
| SMILES | O=C(NCCCOCC1CCCO1)Nc1nccs1 |
| InChI | InChI=1S/C12H19N3O3S/c16-11(15-12-14-5-8-19-12)13-4-2-6-17-9-10-3-1-7-18-10/h5,8,10H,1-4,6-7,9H2,(H2,13,14,15,16) |
| InChIKey | NRKIKMIABADTOX-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|