C17H24N2O5 — CID 38164885
1-(1,3-benzodioxol-5-ylmethyl)-3-[3-[[(2R)-oxolan-2-yl]methoxy]propyl]urea (PubChem CID 38164885) has the molecular formula C17H24N2O5 and a molecular weight of 336.39 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-3-[3-[[(2R)-oxolan-2-yl]methoxy]propyl]urea.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-[3-[[(2R)-oxolan-2-yl]methoxy]propyl]urea |
|---|---|
| PubChem CID | 38164885 |
| Molecular Formula | C17H24N2O5 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-[3-[[(2R)-oxolan-2-yl]methoxy]propyl]urea |
| SMILES | O=C(NCCCOC[C@H]1CCCO1)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H24N2O5/c20-17(18-6-2-7-21-11-14-3-1-8-22-14)19-10-13-4-5-15-16(9-13)24-12-23-15/h4-5,9,14H,1-3,6-8,10-12H2,(H2,18,19,20)/t14-/m1/s1 |
| InChIKey | YVPORWSIHYSWMG-CQSZACIVSA-N |
| XLogP | 1.80 |
| TPSA | 78.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|