C18H22N4O4 — CID 121145357
1-(1,3-benzodioxol-5-ylmethyl)-3-[1-(oxan-2-ylmethyl)pyrazol-4-yl]urea (PubChem CID 121145357) has the molecular formula C18H22N4O4 and a molecular weight of 358.40 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-3-[1-(oxan-2-ylmethyl)pyrazol-4-yl]urea.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-[1-(oxan-2-ylmethyl)pyrazol-4-yl]urea |
|---|---|
| PubChem CID | 121145357 |
| Molecular Formula | C18H22N4O4 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-[1-(oxan-2-ylmethyl)pyrazol-4-yl]urea |
| SMILES | O=C(NCc1ccc2c(c1)OCO2)Nc1cnn(CC2CCCCO2)c1 |
| InChI | InChI=1S/C18H22N4O4/c23-18(19-8-13-4-5-16-17(7-13)26-12-25-16)21-14-9-20-22(10-14)11-15-3-1-2-6-24-15/h4-5,7,9-10,15H,1-3,6,8,11-12H2,(H2,19,21,23) |
| InChIKey | LULXOJSNHUMWBH-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 86.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |