C16H19N3O3S — CID 94025132
1-[[4-[[(2R)-oxolan-2-yl]methoxy]phenyl]methyl]-3-(1,3-thiazol-2-yl)urea (PubChem CID 94025132) has the molecular formula C16H19N3O3S and a molecular weight of 333.41 g/mol. Its IUPAC name is 1-[[4-[[(2R)-oxolan-2-yl]methoxy]phenyl]methyl]-3-(1,3-thiazol-2-yl)urea.
| Compound Name | 1-[[4-[[(2R)-oxolan-2-yl]methoxy]phenyl]methyl]-3-(1,3-thiazol-2-yl)urea |
|---|---|
| PubChem CID | 94025132 |
| Molecular Formula | C16H19N3O3S |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | 1-[[4-[[(2R)-oxolan-2-yl]methoxy]phenyl]methyl]-3-(1,3-thiazol-2-yl)urea |
| SMILES | O=C(NCc1ccc(OC[C@H]2CCCO2)cc1)Nc1nccs1 |
| InChI | InChI=1S/C16H19N3O3S/c20-15(19-16-17-7-9-23-16)18-10-12-3-5-13(6-4-12)22-11-14-2-1-8-21-14/h3-7,9,14H,1-2,8,10-11H2,(H2,17,18,19,20)/t14-/m1/s1 |
| InChIKey | QYGUVAKDTHRZSL-CQSZACIVSA-N |
| XLogP | 3.02 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |