C17H26N4O3 — CID 52991180
1-[[4-(oxolan-2-ylmethoxy)phenyl]methyl]-3-(pyrazolidin-3-ylmethyl)urea (PubChem CID 52991180) has the molecular formula C17H26N4O3 and a molecular weight of 334.42 g/mol. Its IUPAC name is 1-[[4-(oxolan-2-ylmethoxy)phenyl]methyl]-3-(pyrazolidin-3-ylmethyl)urea.
| Compound Name | 1-[[4-(oxolan-2-ylmethoxy)phenyl]methyl]-3-(pyrazolidin-3-ylmethyl)urea |
|---|---|
| PubChem CID | 52991180 |
| Molecular Formula | C17H26N4O3 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | 1-[[4-(oxolan-2-ylmethoxy)phenyl]methyl]-3-(pyrazolidin-3-ylmethyl)urea |
| SMILES | O=C(NCc1ccc(OCC2CCCO2)cc1)NCC1CCNN1 |
| InChI | InChI=1S/C17H26N4O3/c22-17(19-11-14-7-8-20-21-14)18-10-13-3-5-15(6-4-13)24-12-16-2-1-9-23-16/h3-6,14,16,20-21H,1-2,7-12H2,(H2,18,19,22) |
| InChIKey | JJDPRIDPOWVTDY-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 83.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |