C17H19N3OS2 — CID 78892698
1-[3-(1,3-dithiolan-2-yl)phenyl]-3-[(6-methyl-2-pyridinyl)methyl]urea (PubChem CID 78892698) has the molecular formula C17H19N3OS2 and a molecular weight of 345.49 g/mol. Its IUPAC name is 1-[3-(1,3-dithiolan-2-yl)phenyl]-3-[(6-methyl-2-pyridinyl)methyl]urea.
| Compound Name | 1-[3-(1,3-dithiolan-2-yl)phenyl]-3-[(6-methyl-2-pyridinyl)methyl]urea |
|---|---|
| PubChem CID | 78892698 |
| Molecular Formula | C17H19N3OS2 |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | 1-[3-(1,3-dithiolan-2-yl)phenyl]-3-[(6-methyl-2-pyridinyl)methyl]urea |
| SMILES | Cc1cccc(CNC(=O)Nc2cccc(C3SCCS3)c2)n1 |
| InChI | InChI=1S/C17H19N3OS2/c1-12-4-2-7-15(19-12)11-18-17(21)20-14-6-3-5-13(10-14)16-22-8-9-23-16/h2-7,10,16H,8-9,11H2,1H3,(H2,18,20,21) |
| InChIKey | YTUSQGUDTZEOAB-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |