C15H21NOS2 — CID 78811150
N-[3-(1,3-dithiolan-2-yl)phenyl]-2-methylpentanamide (PubChem CID 78811150) has the molecular formula C15H21NOS2 and a molecular weight of 295.47 g/mol. Its IUPAC name is N-[3-(1,3-dithiolan-2-yl)phenyl]-2-methylpentanamide.
| Compound Name | N-[3-(1,3-dithiolan-2-yl)phenyl]-2-methylpentanamide |
|---|---|
| PubChem CID | 78811150 |
| Molecular Formula | C15H21NOS2 |
| Molecular Weight | 295.47 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | N-[3-(1,3-dithiolan-2-yl)phenyl]-2-methylpentanamide |
| SMILES | CCCC(C)C(=O)Nc1cccc(C2SCCS2)c1 |
| InChI | InChI=1S/C15H21NOS2/c1-3-5-11(2)14(17)16-13-7-4-6-12(10-13)15-18-8-9-19-15/h4,6-7,10-11,15H,3,5,8-9H2,1-2H3,(H,16,17) |
| InChIKey | VRLWDCQCIYZKJB-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.47 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |