C16H17NO2S3 — CID 27658327
N-[3-(1,3-dithiolan-2-yl)phenyl]-4-methylbenzenesulfonamide (PubChem CID 27658327) has the molecular formula C16H17NO2S3 and a molecular weight of 351.52 g/mol. Its IUPAC name is N-[3-(1,3-dithiolan-2-yl)phenyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[3-(1,3-dithiolan-2-yl)phenyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 27658327 |
| Molecular Formula | C16H17NO2S3 |
| Molecular Weight | 351.52 g/mol |
| Exact Mass | 351.04 |
| IUPAC Name | N-[3-(1,3-dithiolan-2-yl)phenyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2cccc(C3SCCS3)c2)cc1 |
| InChI | InChI=1S/C16H17NO2S3/c1-12-5-7-15(8-6-12)22(18,19)17-14-4-2-3-13(11-14)16-20-9-10-21-16/h2-8,11,16-17H,9-10H2,1H3 |
| InChIKey | DMTMSPMSKPAWEN-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.52 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |