C18H19NO5S3 — CID 91641714
methyl 5-[[3-(1,3-dithian-2-yl)phenyl]sulfamoyl]-2-hydroxybenzoate (PubChem CID 91641714) has the molecular formula C18H19NO5S3 and a molecular weight of 425.55 g/mol. Its IUPAC name is methyl 5-[[3-(1,3-dithian-2-yl)phenyl]sulfamoyl]-2-hydroxybenzoate.
| Compound Name | methyl 5-[[3-(1,3-dithian-2-yl)phenyl]sulfamoyl]-2-hydroxybenzoate |
|---|---|
| PubChem CID | 91641714 |
| Molecular Formula | C18H19NO5S3 |
| Molecular Weight | 425.55 g/mol |
| Exact Mass | 425.04 |
| IUPAC Name | methyl 5-[[3-(1,3-dithian-2-yl)phenyl]sulfamoyl]-2-hydroxybenzoate |
| SMILES | COC(=O)c1cc(S(=O)(=O)Nc2cccc(C3SCCCS3)c2)ccc1O |
| InChI | InChI=1S/C18H19NO5S3/c1-24-17(21)15-11-14(6-7-16(15)20)27(22,23)19-13-5-2-4-12(10-13)18-25-8-3-9-26-18/h2,4-7,10-11,18-20H,3,8-9H2,1H3 |
| InChIKey | PTIDZJOFXLSTSD-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.55 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |