C17H16N2O8S — CID 55878671
2-[[4-[(4-hydroxy-3-methoxycarbonylphenyl)sulfonylamino]benzoyl]amino]acetic acid (PubChem CID 55878671) has the molecular formula C17H16N2O8S and a molecular weight of 408.39 g/mol. Its IUPAC name is 2-[[4-[(4-hydroxy-3-methoxycarbonylphenyl)sulfonylamino]benzoyl]amino]acetic acid.
| Compound Name | 2-[[4-[(4-hydroxy-3-methoxycarbonylphenyl)sulfonylamino]benzoyl]amino]acetic acid |
|---|---|
| PubChem CID | 55878671 |
| Molecular Formula | C17H16N2O8S |
| Molecular Weight | 408.39 g/mol |
| Exact Mass | 408.06 |
| IUPAC Name | 2-[[4-[(4-hydroxy-3-methoxycarbonylphenyl)sulfonylamino]benzoyl]amino]acetic acid |
| SMILES | COC(=O)c1cc(S(=O)(=O)Nc2ccc(C(=O)NCC(=O)O)cc2)ccc1O |
| InChI | InChI=1S/C17H16N2O8S/c1-27-17(24)13-8-12(6-7-14(13)20)28(25,26)19-11-4-2-10(3-5-11)16(23)18-9-15(21)22/h2-8,19-20H,9H2,1H3,(H,18,23)(H,21,22) |
| InChIKey | CNBSOUWIJXPSLT-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 159.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.39 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |