C18H21NO2S3 — CID 27658350
N-[3-(1,3-dithiolan-2-yl)phenyl]-4-propan-2-ylbenzenesulfonamide (PubChem CID 27658350) has the molecular formula C18H21NO2S3 and a molecular weight of 379.57 g/mol. Its IUPAC name is N-[3-(1,3-dithiolan-2-yl)phenyl]-4-propan-2-ylbenzenesulfonamide.
| Compound Name | N-[3-(1,3-dithiolan-2-yl)phenyl]-4-propan-2-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 27658350 |
| Molecular Formula | C18H21NO2S3 |
| Molecular Weight | 379.57 g/mol |
| Exact Mass | 379.07 |
| IUPAC Name | N-[3-(1,3-dithiolan-2-yl)phenyl]-4-propan-2-ylbenzenesulfonamide |
| SMILES | CC(C)c1ccc(S(=O)(=O)Nc2cccc(C3SCCS3)c2)cc1 |
| InChI | InChI=1S/C18H21NO2S3/c1-13(2)14-6-8-17(9-7-14)24(20,21)19-16-5-3-4-15(12-16)18-22-10-11-23-18/h3-9,12-13,18-19H,10-11H2,1-2H3 |
| InChIKey | XGSNAQGOBXJGJS-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.57 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |