C16H13ClN2O3S2 — CID 26379703
4-chloro-N-[3-(1,3-dithiolan-2-yl)phenyl]-2-nitrobenzamide (PubChem CID 26379703) has the molecular formula C16H13ClN2O3S2 and a molecular weight of 380.88 g/mol. Its IUPAC name is 4-chloro-N-[3-(1,3-dithiolan-2-yl)phenyl]-2-nitrobenzamide.
| Compound Name | 4-chloro-N-[3-(1,3-dithiolan-2-yl)phenyl]-2-nitrobenzamide |
|---|---|
| PubChem CID | 26379703 |
| Molecular Formula | C16H13ClN2O3S2 |
| Molecular Weight | 380.88 g/mol |
| Exact Mass | 380.01 |
| IUPAC Name | 4-chloro-N-[3-(1,3-dithiolan-2-yl)phenyl]-2-nitrobenzamide |
| SMILES | O=C(Nc1cccc(C2SCCS2)c1)c1ccc(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H13ClN2O3S2/c17-11-4-5-13(14(9-11)19(21)22)15(20)18-12-3-1-2-10(8-12)16-23-6-7-24-16/h1-5,8-9,16H,6-7H2,(H,18,20) |
| InChIKey | MUXXZNIMOKFEPN-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.88 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|