C11H12I3NO — CID 60629696
N-tert-butyl-2,3,5-triiodobenzamide (PubChem CID 60629696) has the molecular formula C11H12I3NO and a molecular weight of 554.94 g/mol. Its IUPAC name is N-tert-butyl-2,3,5-triiodobenzamide.
| Compound Name | N-tert-butyl-2,3,5-triiodobenzamide |
|---|---|
| PubChem CID | 60629696 |
| Molecular Formula | C11H12I3NO |
| Molecular Weight | 554.94 g/mol |
| Exact Mass | 554.81 |
| IUPAC Name | N-tert-butyl-2,3,5-triiodobenzamide |
| SMILES | CC(C)(C)NC(=O)c1cc(I)cc(I)c1I |
| InChI | InChI=1S/C11H12I3NO/c1-11(2,3)15-10(16)7-4-6(12)5-8(13)9(7)14/h4-5H,1-3H3,(H,15,16) |
| InChIKey | JBAYGBDKPULWPT-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.94 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|