C13H7I4NO3S — CID 152996078
2,3,5-triiodo-N-(2-iodophenyl)sulfonylbenzamide (PubChem CID 152996078) has the molecular formula C13H7I4NO3S and a molecular weight of 764.89 g/mol. Its IUPAC name is 2,3,5-triiodo-N-(2-iodophenyl)sulfonylbenzamide.
| Compound Name | 2,3,5-triiodo-N-(2-iodophenyl)sulfonylbenzamide |
|---|---|
| PubChem CID | 152996078 |
| Molecular Formula | C13H7I4NO3S |
| Molecular Weight | 764.89 g/mol |
| Exact Mass | 764.63 |
| IUPAC Name | 2,3,5-triiodo-N-(2-iodophenyl)sulfonylbenzamide |
| SMILES | O=C(NS(=O)(=O)c1ccccc1I)c1cc(I)cc(I)c1I |
| InChI | InChI=1S/C13H7I4NO3S/c14-7-5-8(12(17)10(16)6-7)13(19)18-22(20,21)11-4-2-1-3-9(11)15/h1-6H,(H,18,19) |
| InChIKey | UXFOFQNYOGEWCJ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.89 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|