C28H32I3NO3S — CID 153287257
2,3,5-triiodo-N-(2,4,6-tricyclopentylphenyl)sulfonylbenzamide (PubChem CID 153287257) has the molecular formula C28H32I3NO3S and a molecular weight of 843.35 g/mol. Its IUPAC name is 2,3,5-triiodo-N-(2,4,6-tricyclopentylphenyl)sulfonylbenzamide.
| Compound Name | 2,3,5-triiodo-N-(2,4,6-tricyclopentylphenyl)sulfonylbenzamide |
|---|---|
| PubChem CID | 153287257 |
| Molecular Formula | C28H32I3NO3S |
| Molecular Weight | 843.35 g/mol |
| Exact Mass | 842.92 |
| IUPAC Name | 2,3,5-triiodo-N-(2,4,6-tricyclopentylphenyl)sulfonylbenzamide |
| SMILES | O=C(NS(=O)(=O)c1c(C2CCCC2)cc(C2CCCC2)cc1C1CCCC1)c1cc(I)cc(I)c1I |
| InChI | InChI=1S/C28H32I3NO3S/c29-21-15-24(26(31)25(30)16-21)28(33)32-36(34,35)27-22(18-9-3-4-10-18)13-20(17-7-1-2-8-17)14-23(27)19-11-5-6-12-19/h13-19H,1-12H2,(H,32,33) |
| InChIKey | IZHDQQCREGBJAS-UHFFFAOYSA-N |
| XLogP | 8.59 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 843.35 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|