About N-butylsulfonyl-2,3,5-triiodobenzamide
N-butylsulfonyl-2,3,5-triiodobenzamide (PubChem CID 153287282) has the molecular formula C11H12I3NO3S
and a molecular weight of 619.00 g/mol. Its IUPAC name is N-butylsulfonyl-2,3,5-triiodobenzamide.
Molecular Properties
| Compound Name | N-butylsulfonyl-2,3,5-triiodobenzamide |
| PubChem CID | 153287282 |
| Molecular Formula | C11H12I3NO3S |
| Molecular Weight | 619.00 g/mol |
| Exact Mass | 618.77 |
| IUPAC Name | N-butylsulfonyl-2,3,5-triiodobenzamide |
| SMILES | CCCCS(=O)(=O)NC(=O)c1cc(I)cc(I)c1I |
| InChI | InChI=1S/C11H12I3NO3S/c1-2-3-4-19(17,18)15-11(16)8-5-7(12)6-9(13)10(8)14/h5-6H,2-4H2,1H3,(H,15,16) |
| InChIKey | XFFJRTIRMRCAPK-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 619.00 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze N-butylsulfonyl-2,3,5-triiodobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butylsulfonyl-2,3,5-triiodobenzamide?
The IUPAC name of N-butylsulfonyl-2,3,5-triiodobenzamide (CID 153287282) is N-butylsulfonyl-2,3,5-triiodobenzamide.
What is the SMILES notation for N-butylsulfonyl-2,3,5-triiodobenzamide?
The canonical SMILES for N-butylsulfonyl-2,3,5-triiodobenzamide is CCCCS(=O)(=O)NC(=O)c1cc(I)cc(I)c1I.
What is the InChIKey of N-butylsulfonyl-2,3,5-triiodobenzamide?
The InChIKey is XFFJRTIRMRCAPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12I3NO3S/c1-2-3-4-19(17,18)15-11(16)8-5-7(12)6-9(13)10(8)14/h5-6H,2-4H2,1H3,(H,15,16).
What are the key properties of N-butylsulfonyl-2,3,5-triiodobenzamide?
N-butylsulfonyl-2,3,5-triiodobenzamide has a molecular weight of 619.00 g/mol, XLogP of 3.36, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-butylsulfonyl-2,3,5-triiodobenzamide is sourced from PubChem (CID 153287282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).