C10H8I3NO — CID 4551510
2,3,5-triiodo-N-prop-2-enylbenzamide (PubChem CID 4551510) has the molecular formula C10H8I3NO and a molecular weight of 538.89 g/mol. Its IUPAC name is 2,3,5-triiodo-N-prop-2-enylbenzamide.
| Compound Name | 2,3,5-triiodo-N-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 4551510 |
| Molecular Formula | C10H8I3NO |
| Molecular Weight | 538.89 g/mol |
| Exact Mass | 538.77 |
| IUPAC Name | 2,3,5-triiodo-N-prop-2-enylbenzamide |
| SMILES | C=CCNC(=O)c1cc(I)cc(I)c1I |
| InChI | InChI=1S/C10H8I3NO/c1-2-3-14-10(15)7-4-6(11)5-8(12)9(7)13/h2,4-5H,1,3H2,(H,14,15) |
| InChIKey | CKCZRUNIEXCXCM-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.89 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|