C17H14ClIN2O2 — CID 2197329
2-[(2-chlorobenzoyl)amino]-5-iodo-N-prop-2-enylbenzamide (PubChem CID 2197329) has the molecular formula C17H14ClIN2O2 and a molecular weight of 440.67 g/mol. Its IUPAC name is 2-[(2-chlorobenzoyl)amino]-5-iodo-N-prop-2-enylbenzamide.
| Compound Name | 2-[(2-chlorobenzoyl)amino]-5-iodo-N-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 2197329 |
| Molecular Formula | C17H14ClIN2O2 |
| Molecular Weight | 440.67 g/mol |
| Exact Mass | 439.98 |
| IUPAC Name | 2-[(2-chlorobenzoyl)amino]-5-iodo-N-prop-2-enylbenzamide |
| SMILES | C=CCNC(=O)c1cc(I)ccc1NC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C17H14ClIN2O2/c1-2-9-20-16(22)13-10-11(19)7-8-15(13)21-17(23)12-5-3-4-6-14(12)18/h2-8,10H,1,9H2,(H,20,22)(H,21,23) |
| InChIKey | JYXMODHCRVPPBL-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.67 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|